C12H11ClFIN2O — CID 88961368
(E)-3-chloro-N-cyclopropyl-3-(2-fluoro-4-iodoanilino)prop-2-enamide (PubChem CID 88961368) has the molecular formula C12H11ClFIN2O and a molecular weight of 380.59 g/mol. Its IUPAC name is (E)-3-chloro-N-cyclopropyl-3-(2-fluoro-4-iodoanilino)prop-2-enamide.
| Compound Name | (E)-3-chloro-N-cyclopropyl-3-(2-fluoro-4-iodoanilino)prop-2-enamide |
|---|---|
| PubChem CID | 88961368 |
| Molecular Formula | C12H11ClFIN2O |
| Molecular Weight | 380.59 g/mol |
| Exact Mass | 379.96 |
| IUPAC Name | (E)-3-chloro-N-cyclopropyl-3-(2-fluoro-4-iodoanilino)prop-2-enamide |
| SMILES | O=C(/C=C(/Cl)Nc1ccc(I)cc1F)NC1CC1 |
| InChI | InChI=1S/C12H11ClFIN2O/c13-11(6-12(18)16-8-2-3-8)17-10-4-1-7(15)5-9(10)14/h1,4-6,8,17H,2-3H2,(H,16,18)/b11-6- |
| InChIKey | RUBUJNULTPEVKF-WDZFZDKYSA-N |
| XLogP | 3.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.59 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|