C34H48N2O4 — CID 88988407
(4S,4aS,6aR,6aR,6bR,8aS,12aS,14aR,14bS)-2-isocyano-4,6a,6b,11,11,14b-hexamethyl-8a-(morpholine-4-carbonyl)-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydro-4H-picene-3,13-dione (PubChem CID 88988407) has the molecular formula C34H48N2O4 and a molecular weight of 548.77 g/mol. Its IUPAC name is (4S,4aS,6aR,6aR,6bR,8aS,12aS,14aR,14bS)-2-isocyano-4,6a,6b,11,11,14b-hexamethyl-8a-(morpholine-4-carbonyl)-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydro-4H-picene-3,13-dione.
| Compound Name | (4S,4aS,6aR,6aR,6bR,8aS,12aS,14aR,14bS)-2-isocyano-4,6a,6b,11,11,14b-hexamethyl-8a-(morpholine-4-carbonyl)-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydro-4H-picene-3,13-dione |
|---|---|
| PubChem CID | 88988407 |
| Molecular Formula | C34H48N2O4 |
| Molecular Weight | 548.77 g/mol |
| Exact Mass | 548.36 |
| IUPAC Name | (4S,4aS,6aR,6aR,6bR,8aS,12aS,14aR,14bS)-2-isocyano-4,6a,6b,11,11,14b-hexamethyl-8a-(morpholine-4-carbonyl)-4a,5,6,6a,7,8,9,10,12,12a,14,14a-dodecahydro-4H-picene-3,13-dione |
| SMILES | [C-]#[N+]C1=C[C@]2(C)[C@H]3CC(=O)[C@@H]4[C@@H]5CC(C)(C)CC[C@]5(C(=O)N5CCOCC5)CC[C@@]4(C)[C@]3(C)CC[C@H]2[C@H](C)C1=O |
| InChI | InChI=1S/C34H48N2O4/c1-21-22-8-9-32(5)26(31(22,4)20-24(35-7)28(21)38)18-25(37)27-23-19-30(2,3)10-12-34(23,13-11-33(27,32)6)29(39)36-14-16-40-17-15-36/h20-23,26-27H,8-19H2,1-6H3/t21-,22-,23-,26+,27-,31-,32+,33+,34-/m0/s1 |
| InChIKey | QFUMZRRKJPRACD-RYQIJDEVSA-N |
| XLogP | 6.11 |
| TPSA | 68.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.77 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|