About ethoxyethane;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;pentyl benzoate
ethoxyethane;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;pentyl benzoate (PubChem CID 88992818) has the molecular formula C22H40O7
and a molecular weight of 416.56 g/mol. Its IUPAC name is ethoxyethane;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;pentyl benzoate.
Molecular Properties
| Compound Name | ethoxyethane;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;pentyl benzoate |
| PubChem CID | 88992818 |
| Molecular Formula | C22H40O7 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | ethoxyethane;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;pentyl benzoate |
| SMILES | CCCCCOC(=O)c1ccccc1.CCOCC.OCCOCCOCCO |
| InChI | InChI=1S/C12H16O2.C6H14O4.C4H10O/c1-2-3-7-10-14-12(13)11-8-5-4-6-9-11;7-1-3-9-5-6-10-4-2-8;1-3-5-4-2/h4-6,8-9H,2-3,7,10H2,1H3;7-8H,1-6H2;3-4H2,1-2H3 |
| InChIKey | CAKSJSRTKOXEHR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethoxyethane;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;pentyl benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethoxyethane;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;pentyl benzoate?
The IUPAC name of ethoxyethane;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;pentyl benzoate (CID 88992818) is ethoxyethane;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;pentyl benzoate.
What is the SMILES notation for ethoxyethane;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;pentyl benzoate?
The canonical SMILES for ethoxyethane;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;pentyl benzoate is CCCCCOC(=O)c1ccccc1.CCOCC.OCCOCCOCCO.
What is the InChIKey of ethoxyethane;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;pentyl benzoate?
The InChIKey is CAKSJSRTKOXEHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2.C6H14O4.C4H10O/c1-2-3-7-10-14-12(13)11-8-5-4-6-9-11;7-1-3-9-5-6-10-4-2-8;1-3-5-4-2/h4-6,8-9H,2-3,7,10H2,1H3;7-8H,1-6H2;3-4H2,1-2H3.
What are the key properties of ethoxyethane;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;pentyl benzoate?
ethoxyethane;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;pentyl benzoate has a molecular weight of 416.56 g/mol, XLogP of 3.08, 14 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethoxyethane;2-[2-(2-hydroxyethoxy)ethoxy]ethanol;pentyl benzoate is sourced from PubChem (CID 88992818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).