C31H39N3O4S2 — CID 89023764
(2R,13S,17R,18S,20S)-17,20-dihydroxy-2,18-dimethyl-7-[3-(2-methylsulfanylethylcarbamoyl)phenyl]-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioic S-acid (PubChem CID 89023764) has the molecular formula C31H39N3O4S2 and a molecular weight of 581.80 g/mol. Its IUPAC name is (2R,13S,17R,18S,20S)-17,20-dihydroxy-2,18-dimethyl-7-[3-(2-methylsulfanylethylcarbamoyl)phenyl]-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioic S-acid.
| Compound Name | (2R,13S,17R,18S,20S)-17,20-dihydroxy-2,18-dimethyl-7-[3-(2-methylsulfanylethylcarbamoyl)phenyl]-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioic S-acid |
|---|---|
| PubChem CID | 89023764 |
| Molecular Formula | C31H39N3O4S2 |
| Molecular Weight | 581.80 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | (2R,13S,17R,18S,20S)-17,20-dihydroxy-2,18-dimethyl-7-[3-(2-methylsulfanylethylcarbamoyl)phenyl]-6,7-diazapentacyclo[11.7.0.02,10.04,8.014,18]icosa-4(8),5,9-triene-17-carbothioic S-acid |
| SMILES | CSCCNC(=O)c1cccc(-n2ncc3c2C=C2CC[C@@H]4C(C(O)C[C@@]5(C)C4CC[C@]5(O)C(=O)S)[C@@]2(C)C3)c1 |
| InChI | InChI=1S/C31H39N3O4S2/c1-29-15-19-17-33-34(21-6-4-5-18(13-21)27(36)32-11-12-40-3)24(19)14-20(29)7-8-22-23-9-10-31(38,28(37)39)30(23,2)16-25(35)26(22)29/h4-6,13-14,17,22-23,25-26,35,38H,7-12,15-16H2,1-3H3,(H,32,36)(H,37,39)/t22-,23?,25?,26?,29-,30-,31-/m0/s1 |
| InChIKey | VGUSDCJVGYRLAI-KKUTVNLFSA-N |
| XLogP | 4.31 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.80 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|