C31H33Cl2N3O6S — CID 89030204
3-[[[(3S,4S)-3-(2,4-dichlorocyclohexa-2,4-dien-1-yl)-2-[(1R,2R)-2-(methanesulfinamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]benzoic acid (PubChem CID 89030204) has the molecular formula C31H33Cl2N3O6S and a molecular weight of 646.59 g/mol. Its IUPAC name is 3-[[[(3S,4S)-3-(2,4-dichlorocyclohexa-2,4-dien-1-yl)-2-[(1R,2R)-2-(methanesulfinamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]benzoic acid.
| Compound Name | 3-[[[(3S,4S)-3-(2,4-dichlorocyclohexa-2,4-dien-1-yl)-2-[(1R,2R)-2-(methanesulfinamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]benzoic acid |
|---|---|
| PubChem CID | 89030204 |
| Molecular Formula | C31H33Cl2N3O6S |
| Molecular Weight | 646.59 g/mol |
| Exact Mass | 645.15 |
| IUPAC Name | 3-[[[(3S,4S)-3-(2,4-dichlorocyclohexa-2,4-dien-1-yl)-2-[(1R,2R)-2-(methanesulfinamido)cyclohexyl]-1-oxo-3,4-dihydroisoquinoline-4-carbonyl]amino]oxymethyl]benzoic acid |
| SMILES | CS(=O)N[C@@H]1CCCC[C@H]1N1C(=O)c2ccccc2[C@H](C(=O)NOCc2cccc(C(=O)O)c2)[C@H]1C1CC=C(Cl)C=C1Cl |
| InChI | InChI=1S/C31H33Cl2N3O6S/c1-43(41)35-25-11-4-5-12-26(25)36-28(23-14-13-20(32)16-24(23)33)27(21-9-2-3-10-22(21)30(36)38)29(37)34-42-17-18-7-6-8-19(15-18)31(39)40/h2-3,6-10,13,15-16,23,25-28,35H,4-5,11-12,14,17H2,1H3,(H,34,37)(H,39,40)/t23?,25-,26-,27+,28-,43?/m1/s1 |
| InChIKey | WSFMNRBXNQVOTF-CJCMRHLNSA-N |
| XLogP | 5.00 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.59 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|