C35H41F3O — CID 89045980
1-[(Z)-but-1-enoxy]-2,3-difluoro-4-[4-[2-fluoro-4-(5-prop-2-enyldecan-2-yl)phenyl]phenyl]benzene (PubChem CID 89045980) has the molecular formula C35H41F3O and a molecular weight of 534.71 g/mol. Its IUPAC name is 1-[(Z)-but-1-enoxy]-2,3-difluoro-4-[4-[2-fluoro-4-(5-prop-2-enyldecan-2-yl)phenyl]phenyl]benzene.
| Compound Name | 1-[(Z)-but-1-enoxy]-2,3-difluoro-4-[4-[2-fluoro-4-(5-prop-2-enyldecan-2-yl)phenyl]phenyl]benzene |
|---|---|
| PubChem CID | 89045980 |
| Molecular Formula | C35H41F3O |
| Molecular Weight | 534.71 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | 1-[(Z)-but-1-enoxy]-2,3-difluoro-4-[4-[2-fluoro-4-(5-prop-2-enyldecan-2-yl)phenyl]phenyl]benzene |
| SMILES | C=CCC(CCCCC)CCC(C)c1ccc(-c2ccc(-c3ccc(O/C=C\CC)c(F)c3F)cc2)c(F)c1 |
| InChI | InChI=1S/C35H41F3O/c1-5-8-10-12-26(11-7-3)14-13-25(4)29-19-20-30(32(36)24-29)27-15-17-28(18-16-27)31-21-22-33(35(38)34(31)37)39-23-9-6-2/h7,9,15-26H,3,5-6,8,10-14H2,1-2,4H3/b23-9- |
| InChIKey | OAHGTDIWOCDWNL-AQHIEDMUSA-N |
| XLogP | 11.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.71 |
| LogP ≤ 5 | 11.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|