C11H16N2 — CID 89050043
1-(3a,4-dihydro-1H-indol-3-yl)propan-2-amine (PubChem CID 89050043) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 1-(3a,4-dihydro-1H-indol-3-yl)propan-2-amine.
| Compound Name | 1-(3a,4-dihydro-1H-indol-3-yl)propan-2-amine |
|---|---|
| PubChem CID | 89050043 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 1-(3a,4-dihydro-1H-indol-3-yl)propan-2-amine |
| SMILES | CC(N)CC1=CNC2=CC=CCC12 |
| InChI | InChI=1S/C11H16N2/c1-8(12)6-9-7-13-11-5-3-2-4-10(9)11/h2-3,5,7-8,10,13H,4,6,12H2,1H3 |
| InChIKey | XUMDIQZANHRONX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |