C6H13N3 — CID 89084459
N'-[(Z)-3-iminoprop-1-enyl]-N'-methylethane-1,2-diamine (PubChem CID 89084459) has the molecular formula C6H13N3 and a molecular weight of 127.19 g/mol. Its IUPAC name is N'-[(Z)-3-iminoprop-1-enyl]-N'-methylethane-1,2-diamine.
| Compound Name | N'-[(Z)-3-iminoprop-1-enyl]-N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 89084459 |
| Molecular Formula | C6H13N3 |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | N'-[(Z)-3-iminoprop-1-enyl]-N'-methylethane-1,2-diamine |
| SMILES | [H]/N=C/C=C\N(C)CCN |
| InChI | InChI=1S/C6H13N3/c1-9(6-4-8)5-2-3-7/h2-3,5,7H,4,6,8H2,1H3/b5-2-,7-3+ |
| InChIKey | JGARPJQLOIQRSK-CGHHVMRMSA-N |
| XLogP | 0.04 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|