C8H16N2O — CID 135301235
2-[(Z)-4-iminobut-2-en-2-yl]oxy-N,N-dimethylethanamine (PubChem CID 135301235) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 2-[(Z)-4-iminobut-2-en-2-yl]oxy-N,N-dimethylethanamine.
| Compound Name | 2-[(Z)-4-iminobut-2-en-2-yl]oxy-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 135301235 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 2-[(Z)-4-iminobut-2-en-2-yl]oxy-N,N-dimethylethanamine |
| SMILES | [H]/N=C/C=C(/C)OCCN(C)C |
| InChI | InChI=1S/C8H16N2O/c1-8(4-5-9)11-7-6-10(2)3/h4-5,9H,6-7H2,1-3H3/b8-4-,9-5+ |
| InChIKey | AMZGVISXLWXEDN-MVTUOISNSA-N |
| XLogP | 1.12 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|