C23H18Cl2N2O3 — CID 89098262
(3R,4R)-3-(2,4-dichlorophenyl)-1-oxo-N-phenylmethoxy-3,4-dihydro-2H-isoquinoline-4-carboxamide (PubChem CID 89098262) has the molecular formula C23H18Cl2N2O3 and a molecular weight of 441.31 g/mol. Its IUPAC name is (3R,4R)-3-(2,4-dichlorophenyl)-1-oxo-N-phenylmethoxy-3,4-dihydro-2H-isoquinoline-4-carboxamide.
| Compound Name | (3R,4R)-3-(2,4-dichlorophenyl)-1-oxo-N-phenylmethoxy-3,4-dihydro-2H-isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 89098262 |
| Molecular Formula | C23H18Cl2N2O3 |
| Molecular Weight | 441.31 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | (3R,4R)-3-(2,4-dichlorophenyl)-1-oxo-N-phenylmethoxy-3,4-dihydro-2H-isoquinoline-4-carboxamide |
| SMILES | O=C1N[C@@H](c2ccc(Cl)cc2Cl)[C@H](C(=O)NOCc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C23H18Cl2N2O3/c24-15-10-11-18(19(25)12-15)21-20(16-8-4-5-9-17(16)22(28)26-21)23(29)27-30-13-14-6-2-1-3-7-14/h1-12,20-21H,13H2,(H,26,28)(H,27,29)/t20-,21+/m1/s1 |
| InChIKey | DFBRVDFMLJAQDE-RTWAWAEBSA-N |
| XLogP | 4.81 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.31 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|