C24H32N4O2 — CID 89136341
6-[(3Z,5E)-5-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]hepta-1,3,5-trien-2-yl]-2-pyridin-2-yl-4,5-dihydropyridazin-3-one (PubChem CID 89136341) has the molecular formula C24H32N4O2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 6-[(3Z,5E)-5-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]hepta-1,3,5-trien-2-yl]-2-pyridin-2-yl-4,5-dihydropyridazin-3-one.
| Compound Name | 6-[(3Z,5E)-5-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]hepta-1,3,5-trien-2-yl]-2-pyridin-2-yl-4,5-dihydropyridazin-3-one |
|---|---|
| PubChem CID | 89136341 |
| Molecular Formula | C24H32N4O2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 6-[(3Z,5E)-5-[3-[(2R)-2-methylpyrrolidin-1-yl]propoxy]hepta-1,3,5-trien-2-yl]-2-pyridin-2-yl-4,5-dihydropyridazin-3-one |
| SMILES | C=C(/C=C\C(=C/C)OCCCN1CCC[C@H]1C)C1=NN(c2ccccn2)C(=O)CC1 |
| InChI | InChI=1S/C24H32N4O2/c1-4-21(30-18-8-17-27-16-7-9-20(27)3)12-11-19(2)22-13-14-24(29)28(26-22)23-10-5-6-15-25-23/h4-6,10-12,15,20H,2,7-9,13-14,16-18H2,1,3H3/b12-11-,21-4+/t20-/m1/s1 |
| InChIKey | MCLBVWLKJLZRBZ-JSZJUNLDSA-N |
| XLogP | 4.47 |
| TPSA | 58.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|