C22H29NO5S — CID 89140569
[4-[3-[4-(3-oxo-2-propan-2-yloxypropyl)anilino]propyl]phenyl] methanesulfonate (PubChem CID 89140569) has the molecular formula C22H29NO5S and a molecular weight of 419.54 g/mol. Its IUPAC name is [4-[3-[4-(3-oxo-2-propan-2-yloxypropyl)anilino]propyl]phenyl] methanesulfonate.
| Compound Name | [4-[3-[4-(3-oxo-2-propan-2-yloxypropyl)anilino]propyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 89140569 |
| Molecular Formula | C22H29NO5S |
| Molecular Weight | 419.54 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | [4-[3-[4-(3-oxo-2-propan-2-yloxypropyl)anilino]propyl]phenyl] methanesulfonate |
| SMILES | CC(C)OC(C=O)Cc1ccc(NCCCc2ccc(OS(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C22H29NO5S/c1-17(2)27-22(16-24)15-19-6-10-20(11-7-19)23-14-4-5-18-8-12-21(13-9-18)28-29(3,25)26/h6-13,16-17,22-23H,4-5,14-15H2,1-3H3 |
| InChIKey | YKKIKDLXVZRILF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|