C25H29NO5S — CID 89367085
[6-[[4-(4-ethoxy-5-oxopentyl)anilino]methyl]naphthalen-2-yl] methanesulfonate (PubChem CID 89367085) has the molecular formula C25H29NO5S and a molecular weight of 455.58 g/mol. Its IUPAC name is [6-[[4-(4-ethoxy-5-oxopentyl)anilino]methyl]naphthalen-2-yl] methanesulfonate.
| Compound Name | [6-[[4-(4-ethoxy-5-oxopentyl)anilino]methyl]naphthalen-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 89367085 |
| Molecular Formula | C25H29NO5S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | [6-[[4-(4-ethoxy-5-oxopentyl)anilino]methyl]naphthalen-2-yl] methanesulfonate |
| SMILES | CCOC(C=O)CCCc1ccc(NCc2ccc3cc(OS(C)(=O)=O)ccc3c2)cc1 |
| InChI | InChI=1S/C25H29NO5S/c1-3-30-25(18-27)6-4-5-19-8-12-23(13-9-19)26-17-20-7-10-22-16-24(31-32(2,28)29)14-11-21(22)15-20/h7-16,18,25-26H,3-6,17H2,1-2H3 |
| InChIKey | PZYBLRQZZCVPJO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|