C18H19N3O2S — CID 89183069
tert-butyl N-[3-methyl-5-(3-thiocyanato-4-pyridinyl)phenyl]carbamate (PubChem CID 89183069) has the molecular formula C18H19N3O2S and a molecular weight of 341.44 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-5-(3-thiocyanato-4-pyridinyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-5-(3-thiocyanato-4-pyridinyl)phenyl]carbamate |
|---|---|
| PubChem CID | 89183069 |
| Molecular Formula | C18H19N3O2S |
| Molecular Weight | 341.44 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | tert-butyl N-[3-methyl-5-(3-thiocyanato-4-pyridinyl)phenyl]carbamate |
| SMILES | Cc1cc(NC(=O)OC(C)(C)C)cc(-c2ccncc2SC#N)c1 |
| InChI | InChI=1S/C18H19N3O2S/c1-12-7-13(15-5-6-20-10-16(15)24-11-19)9-14(8-12)21-17(22)23-18(2,3)4/h5-10H,1-4H3,(H,21,22) |
| InChIKey | NNSJCXCSOFPMCY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.44 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|