C17H23N3O4S — CID 22572846
[4-tert-butyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-thiocyanatophenyl]carbamic acid (PubChem CID 22572846) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is [4-tert-butyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-thiocyanatophenyl]carbamic acid.
| Compound Name | [4-tert-butyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-thiocyanatophenyl]carbamic acid |
|---|---|
| PubChem CID | 22572846 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | [4-tert-butyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-thiocyanatophenyl]carbamic acid |
| SMILES | CC(C)(C)OC(=O)Nc1cc(C(C)(C)C)c(SC#N)cc1NC(=O)O |
| InChI | InChI=1S/C17H23N3O4S/c1-16(2,3)10-7-11(20-15(23)24-17(4,5)6)12(19-14(21)22)8-13(10)25-9-18/h7-8,19H,1-6H3,(H,20,23)(H,21,22) |
| InChIKey | JTGGNPCKHUNIQF-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 111.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|