C27H40N2O9S2 — CID 89197680
2-[[2-methyl-4-(7-methylidene-1,5-dithiocan-3-yl)-2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxymethyl]-3-oxobutoxy]carbonylamino]ethyl 2-methylprop-2-enoate (PubChem CID 89197680) has the molecular formula C27H40N2O9S2 and a molecular weight of 600.76 g/mol. Its IUPAC name is 2-[[2-methyl-4-(7-methylidene-1,5-dithiocan-3-yl)-2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxymethyl]-3-oxobutoxy]carbonylamino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[2-methyl-4-(7-methylidene-1,5-dithiocan-3-yl)-2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxymethyl]-3-oxobutoxy]carbonylamino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 89197680 |
| Molecular Formula | C27H40N2O9S2 |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.22 |
| IUPAC Name | 2-[[2-methyl-4-(7-methylidene-1,5-dithiocan-3-yl)-2-[2-(2-methylprop-2-enoyloxy)ethylcarbamoyloxymethyl]-3-oxobutoxy]carbonylamino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C1CSCC(CC(=O)C(C)(COC(=O)NCCOC(=O)C(=C)C)COC(=O)NCCOC(=O)C(=C)C)CSC1 |
| InChI | InChI=1S/C27H40N2O9S2/c1-18(2)23(31)35-9-7-28-25(33)37-16-27(6,17-38-26(34)29-8-10-36-24(32)19(3)4)22(30)11-21-14-39-12-20(5)13-40-15-21/h21H,1,3,5,7-17H2,2,4,6H3,(H,28,33)(H,29,34) |
| InChIKey | BHEBJBKFWPIYCE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|