C13H13F3N2O4S2 — CID 89199508
[4-[1-[(Z)-1-amino-3,3,3-trifluoroprop-1-en-2-yl]sulfanylethenylcarbamoyl]phenyl] methanesulfonate (PubChem CID 89199508) has the molecular formula C13H13F3N2O4S2 and a molecular weight of 382.39 g/mol. Its IUPAC name is [4-[1-[(Z)-1-amino-3,3,3-trifluoroprop-1-en-2-yl]sulfanylethenylcarbamoyl]phenyl] methanesulfonate.
| Compound Name | [4-[1-[(Z)-1-amino-3,3,3-trifluoroprop-1-en-2-yl]sulfanylethenylcarbamoyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 89199508 |
| Molecular Formula | C13H13F3N2O4S2 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | [4-[1-[(Z)-1-amino-3,3,3-trifluoroprop-1-en-2-yl]sulfanylethenylcarbamoyl]phenyl] methanesulfonate |
| SMILES | C=C(NC(=O)c1ccc(OS(C)(=O)=O)cc1)S/C(=C\N)C(F)(F)F |
| InChI | InChI=1S/C13H13F3N2O4S2/c1-8(23-11(7-17)13(14,15)16)18-12(19)9-3-5-10(6-4-9)22-24(2,20)21/h3-7H,1,17H2,2H3,(H,18,19)/b11-7- |
| InChIKey | GPCXINATQHJNTE-XFFZJAGNSA-N |
| XLogP | 2.32 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|