C7H5F7O — CID 89202826
5-fluoro-1,5-bis(trifluoromethyl)cyclopent-2-en-1-ol (PubChem CID 89202826) has the molecular formula C7H5F7O and a molecular weight of 238.10 g/mol. Its IUPAC name is 5-fluoro-1,5-bis(trifluoromethyl)cyclopent-2-en-1-ol.
| Compound Name | 5-fluoro-1,5-bis(trifluoromethyl)cyclopent-2-en-1-ol |
|---|---|
| PubChem CID | 89202826 |
| Molecular Formula | C7H5F7O |
| Molecular Weight | 238.10 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 5-fluoro-1,5-bis(trifluoromethyl)cyclopent-2-en-1-ol |
| SMILES | OC1(C(F)(F)F)C=CCC1(F)C(F)(F)F |
| InChI | InChI=1S/C7H5F7O/c8-4(6(9,10)11)2-1-3-5(4,15)7(12,13)14/h1,3,15H,2H2 |
| InChIKey | RHRMPUVEAJBWRI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.10 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|