C15H27N2O9P — CID 89202885
[2-acetyloxy-3-[2-(3-methylpentanoylamino)ethoxy-nitrosophosphoryl]oxypropyl] acetate (PubChem CID 89202885) has the molecular formula C15H27N2O9P and a molecular weight of 410.36 g/mol. Its IUPAC name is [2-acetyloxy-3-[2-(3-methylpentanoylamino)ethoxy-nitrosophosphoryl]oxypropyl] acetate.
| Compound Name | [2-acetyloxy-3-[2-(3-methylpentanoylamino)ethoxy-nitrosophosphoryl]oxypropyl] acetate |
|---|---|
| PubChem CID | 89202885 |
| Molecular Formula | C15H27N2O9P |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | [2-acetyloxy-3-[2-(3-methylpentanoylamino)ethoxy-nitrosophosphoryl]oxypropyl] acetate |
| SMILES | CCC(C)CC(=O)NCCOP(=O)(N=O)OCC(COC(C)=O)OC(C)=O |
| InChI | InChI=1S/C15H27N2O9P/c1-5-11(2)8-15(20)16-6-7-24-27(22,17-21)25-10-14(26-13(4)19)9-23-12(3)18/h11,14H,5-10H2,1-4H3,(H,16,20) |
| InChIKey | GTKWKBCNSLVHPP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 146.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|