C16H27N — CID 89203985
(3E,8Z,10E)-N-(2-methylpropyl)dodeca-1,3,8,10-tetraen-2-amine (PubChem CID 89203985) has the molecular formula C16H27N and a molecular weight of 233.40 g/mol. Its IUPAC name is (3E,8Z,10E)-N-(2-methylpropyl)dodeca-1,3,8,10-tetraen-2-amine.
| Compound Name | (3E,8Z,10E)-N-(2-methylpropyl)dodeca-1,3,8,10-tetraen-2-amine |
|---|---|
| PubChem CID | 89203985 |
| Molecular Formula | C16H27N |
| Molecular Weight | 233.40 g/mol |
| Exact Mass | 233.21 |
| IUPAC Name | (3E,8Z,10E)-N-(2-methylpropyl)dodeca-1,3,8,10-tetraen-2-amine |
| SMILES | C=C(/C=C/CCC/C=C\C=C\C)NCC(C)C |
| InChI | InChI=1S/C16H27N/c1-5-6-7-8-9-10-11-12-13-16(4)17-14-15(2)3/h5-8,12-13,15,17H,4,9-11,14H2,1-3H3/b6-5+,8-7-,13-12+ |
| InChIKey | BZEMHUIBLMLCFE-RQNDBNSFSA-N |
| XLogP | 4.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|