C31H47N7O2 — CID 89209727
3-[amino-[(1Z)-2-amino-3-[(Z)-(methylhydrazinylidene)methyl]buta-1,3-dienyl]amino]-N-[3-tert-butyl-4-methoxy-5-[[methyl(2-methylpropyl)amino]methyl]phenyl]-4-methylbenzamide (PubChem CID 89209727) has the molecular formula C31H47N7O2 and a molecular weight of 549.76 g/mol. Its IUPAC name is 3-[amino-[(1Z)-2-amino-3-[(Z)-(methylhydrazinylidene)methyl]buta-1,3-dienyl]amino]-N-[3-tert-butyl-4-methoxy-5-[[methyl(2-methylpropyl)amino]methyl]phenyl]-4-methylbenzamide.
| Compound Name | 3-[amino-[(1Z)-2-amino-3-[(Z)-(methylhydrazinylidene)methyl]buta-1,3-dienyl]amino]-N-[3-tert-butyl-4-methoxy-5-[[methyl(2-methylpropyl)amino]methyl]phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 89209727 |
| Molecular Formula | C31H47N7O2 |
| Molecular Weight | 549.76 g/mol |
| Exact Mass | 549.38 |
| IUPAC Name | 3-[amino-[(1Z)-2-amino-3-[(Z)-(methylhydrazinylidene)methyl]buta-1,3-dienyl]amino]-N-[3-tert-butyl-4-methoxy-5-[[methyl(2-methylpropyl)amino]methyl]phenyl]-4-methylbenzamide |
| SMILES | C=C(/C=N\NC)/C(N)=C/N(N)c1cc(C(=O)Nc2cc(CN(C)CC(C)C)c(OC)c(C(C)(C)C)c2)ccc1C |
| InChI | InChI=1S/C31H47N7O2/c1-20(2)17-37(9)18-24-13-25(15-26(29(24)40-10)31(5,6)7)36-30(39)23-12-11-21(3)28(14-23)38(33)19-27(32)22(4)16-35-34-8/h11-16,19-20,34H,4,17-18,32-33H2,1-3,5-10H3,(H,36,39)/b27-19-,35-16- |
| InChIKey | AHYNHLUJRAVAKQ-YWYAJQSKSA-N |
| XLogP | 4.88 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.76 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|