C29H33N3O — CID 89214906
(E)-1-(4-benzhydrylpiperazin-1-yl)-3-[4-(ethylaminomethyl)phenyl]prop-2-en-1-one (PubChem CID 89214906) has the molecular formula C29H33N3O and a molecular weight of 439.60 g/mol. Its IUPAC name is (E)-1-(4-benzhydrylpiperazin-1-yl)-3-[4-(ethylaminomethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(4-benzhydrylpiperazin-1-yl)-3-[4-(ethylaminomethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 89214906 |
| Molecular Formula | C29H33N3O |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | (E)-1-(4-benzhydrylpiperazin-1-yl)-3-[4-(ethylaminomethyl)phenyl]prop-2-en-1-one |
| SMILES | CCNCc1ccc(/C=C/C(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C29H33N3O/c1-2-30-23-25-15-13-24(14-16-25)17-18-28(33)31-19-21-32(22-20-31)29(26-9-5-3-6-10-26)27-11-7-4-8-12-27/h3-18,29-30H,2,19-23H2,1H3/b18-17+ |
| InChIKey | CQKABMRBXFVEQK-ISLYRVAYSA-N |
| XLogP | 4.74 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|