C26H43Cl — CID 89228149
(5R)-3-[(E)-7-chloro-5-ethenyl-2-methylidenenon-7-enyl]-5-ethyl-1-(4-methylhexyl)cyclopentene (PubChem CID 89228149) has the molecular formula C26H43Cl and a molecular weight of 391.08 g/mol. Its IUPAC name is (5R)-3-[(E)-7-chloro-5-ethenyl-2-methylidenenon-7-enyl]-5-ethyl-1-(4-methylhexyl)cyclopentene.
| Compound Name | (5R)-3-[(E)-7-chloro-5-ethenyl-2-methylidenenon-7-enyl]-5-ethyl-1-(4-methylhexyl)cyclopentene |
|---|---|
| PubChem CID | 89228149 |
| Molecular Formula | C26H43Cl |
| Molecular Weight | 391.08 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | (5R)-3-[(E)-7-chloro-5-ethenyl-2-methylidenenon-7-enyl]-5-ethyl-1-(4-methylhexyl)cyclopentene |
| SMILES | C=CC(CCC(=C)CC1C=C(CCCC(C)CC)[C@H](CC)C1)C/C(Cl)=C\C |
| InChI | InChI=1S/C26H43Cl/c1-7-20(5)12-11-13-25-18-23(17-24(25)9-3)16-21(6)14-15-22(8-2)19-26(27)10-4/h8,10,18,20,22-24H,2,6-7,9,11-17,19H2,1,3-5H3/b26-10+/t20?,22?,23?,24-/m1/s1 |
| InChIKey | VUVUGMWXEDDXII-ZVTXOAJVSA-N |
| XLogP | 9.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.08 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|