C13H18F2N2O2 — CID 89234249
6-amino-3-butoxy-2,4-difluoro-N,N-dimethylbenzamide (PubChem CID 89234249) has the molecular formula C13H18F2N2O2 and a molecular weight of 272.29 g/mol. Its IUPAC name is 6-amino-3-butoxy-2,4-difluoro-N,N-dimethylbenzamide.
| Compound Name | 6-amino-3-butoxy-2,4-difluoro-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 89234249 |
| Molecular Formula | C13H18F2N2O2 |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 6-amino-3-butoxy-2,4-difluoro-N,N-dimethylbenzamide |
| SMILES | CCCCOc1c(F)cc(N)c(C(=O)N(C)C)c1F |
| InChI | InChI=1S/C13H18F2N2O2/c1-4-5-6-19-12-8(14)7-9(16)10(11(12)15)13(18)17(2)3/h7H,4-6,16H2,1-3H3 |
| InChIKey | ICWZGHGDTYWZPG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|