C19H32O — CID 89234270
(1S,7R,9aS,10S)-1,4a,9a,10-tetramethyl-8-methylidene-2,3,4,4b,5,6,7,9,10,10a-decahydro-1H-benzo[a]azulen-7-ol (PubChem CID 89234270) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is (1S,7R,9aS,10S)-1,4a,9a,10-tetramethyl-8-methylidene-2,3,4,4b,5,6,7,9,10,10a-decahydro-1H-benzo[a]azulen-7-ol.
| Compound Name | (1S,7R,9aS,10S)-1,4a,9a,10-tetramethyl-8-methylidene-2,3,4,4b,5,6,7,9,10,10a-decahydro-1H-benzo[a]azulen-7-ol |
|---|---|
| PubChem CID | 89234270 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | (1S,7R,9aS,10S)-1,4a,9a,10-tetramethyl-8-methylidene-2,3,4,4b,5,6,7,9,10,10a-decahydro-1H-benzo[a]azulen-7-ol |
| SMILES | C=C1C[C@]2(C)C(CC[C@H]1O)C1(C)CCCC(C)C1[C@@H]2C |
| InChI | InChI=1S/C19H32O/c1-12-7-6-10-18(4)16-9-8-15(20)13(2)11-19(16,5)14(3)17(12)18/h12,14-17,20H,2,6-11H2,1,3-5H3/t12?,14-,15+,16?,17?,18?,19-/m0/s1 |
| InChIKey | TVQXRTPATLVKIO-WHYURBOVSA-N |
| XLogP | 4.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|