C20H31N3O4 — CID 89240992
(2S)-N'-hydroxy-N-methyl-N-[1-(methylamino)-1-oxo-4-phenylbutan-2-yl]-2-(2-methylpropyl)butanediamide (PubChem CID 89240992) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is (2S)-N'-hydroxy-N-methyl-N-[1-(methylamino)-1-oxo-4-phenylbutan-2-yl]-2-(2-methylpropyl)butanediamide.
| Compound Name | (2S)-N'-hydroxy-N-methyl-N-[1-(methylamino)-1-oxo-4-phenylbutan-2-yl]-2-(2-methylpropyl)butanediamide |
|---|---|
| PubChem CID | 89240992 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | (2S)-N'-hydroxy-N-methyl-N-[1-(methylamino)-1-oxo-4-phenylbutan-2-yl]-2-(2-methylpropyl)butanediamide |
| SMILES | CNC(=O)C(CCc1ccccc1)N(C)C(=O)[C@H](CC(=O)NO)CC(C)C |
| InChI | InChI=1S/C20H31N3O4/c1-14(2)12-16(13-18(24)22-27)20(26)23(4)17(19(25)21-3)11-10-15-8-6-5-7-9-15/h5-9,14,16-17,27H,10-13H2,1-4H3,(H,21,25)(H,22,24)/t16-,17?/m0/s1 |
| InChIKey | OHTRCVIPZOZVDZ-BHWOMJMDSA-N |
| XLogP | 1.75 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|