C24H35N5O9S — CID 89257888
2-[5-(methanethioylamino)-2-methoxyphenyl]-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 89257888) has the molecular formula C24H35N5O9S and a molecular weight of 569.64 g/mol. Its IUPAC name is 2-[5-(methanethioylamino)-2-methoxyphenyl]-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[5-(methanethioylamino)-2-methoxyphenyl]-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 89257888 |
| Molecular Formula | C24H35N5O9S |
| Molecular Weight | 569.64 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | 2-[5-(methanethioylamino)-2-methoxyphenyl]-2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | COc1ccc(NC=S)cc1C(C(=O)O)N1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C24H35N5O9S/c1-38-19-3-2-17(25-16-39)12-18(19)23(24(36)37)29-10-8-27(14-21(32)33)6-4-26(13-20(30)31)5-7-28(9-11-29)15-22(34)35/h2-3,12,16,23H,4-11,13-15H2,1H3,(H,25,39)(H,30,31)(H,32,33)(H,34,35)(H,36,37) |
| InChIKey | CFWGPOCUZXSPCC-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 183.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.64 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|