C6N6O — CID 89268615
6-isocyanato-1,3,5-triazine-2,4-dicarbonitrile (PubChem CID 89268615) has the molecular formula C6N6O and a molecular weight of 172.11 g/mol. Its IUPAC name is 6-isocyanato-1,3,5-triazine-2,4-dicarbonitrile.
| Compound Name | 6-isocyanato-1,3,5-triazine-2,4-dicarbonitrile |
|---|---|
| PubChem CID | 89268615 |
| Molecular Formula | C6N6O |
| Molecular Weight | 172.11 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | 6-isocyanato-1,3,5-triazine-2,4-dicarbonitrile |
| SMILES | N#Cc1nc(C#N)nc(N=C=O)n1 |
| InChI | InChI=1S/C6N6O/c7-1-4-10-5(2-8)12-6(11-4)9-3-13 |
| InChIKey | RBRNKFYRRZWBKX-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 115.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.11 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|