C6N6O3 — CID 164760982
(4,6-diisocyanato-1,3,5-triazin-2-yl) cyanate (PubChem CID 164760982) has the molecular formula C6N6O3 and a molecular weight of 204.10 g/mol. Its IUPAC name is (4,6-diisocyanato-1,3,5-triazin-2-yl) cyanate.
| Compound Name | (4,6-diisocyanato-1,3,5-triazin-2-yl) cyanate |
|---|---|
| PubChem CID | 164760982 |
| Molecular Formula | C6N6O3 |
| Molecular Weight | 204.10 g/mol |
| Exact Mass | 204.00 |
| IUPAC Name | (4,6-diisocyanato-1,3,5-triazin-2-yl) cyanate |
| SMILES | N#COc1nc(N=C=O)nc(N=C=O)n1 |
| InChI | InChI=1S/C6N6O3/c7-1-15-6-11-4(8-2-13)10-5(12-6)9-3-14 |
| InChIKey | YVRYKVOBFQEMQE-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 130.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.10 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|