C11H12F11I — CID 89292902
2-(difluoromethyl)-1,1,1-trifluoro-8-iodo-2,4-bis(trifluoromethyl)octane (PubChem CID 89292902) has the molecular formula C11H12F11I and a molecular weight of 480.10 g/mol. Its IUPAC name is 2-(difluoromethyl)-1,1,1-trifluoro-8-iodo-2,4-bis(trifluoromethyl)octane.
| Compound Name | 2-(difluoromethyl)-1,1,1-trifluoro-8-iodo-2,4-bis(trifluoromethyl)octane |
|---|---|
| PubChem CID | 89292902 |
| Molecular Formula | C11H12F11I |
| Molecular Weight | 480.10 g/mol |
| Exact Mass | 479.98 |
| IUPAC Name | 2-(difluoromethyl)-1,1,1-trifluoro-8-iodo-2,4-bis(trifluoromethyl)octane |
| SMILES | FC(F)C(CC(CCCCI)C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H12F11I/c12-7(13)8(10(17,18)19,11(20,21)22)5-6(9(14,15)16)3-1-2-4-23/h6-7H,1-5H2 |
| InChIKey | PEETVXLTVHMHLD-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.10 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|