C19H21NO7S2 — CID 89300470
2-[4-[(E)-3-oxo-3-phenylprop-1-enyl]-N-(2-sulfoethyl)anilino]ethanesulfonic acid (PubChem CID 89300470) has the molecular formula C19H21NO7S2 and a molecular weight of 439.51 g/mol. Its IUPAC name is 2-[4-[(E)-3-oxo-3-phenylprop-1-enyl]-N-(2-sulfoethyl)anilino]ethanesulfonic acid.
| Compound Name | 2-[4-[(E)-3-oxo-3-phenylprop-1-enyl]-N-(2-sulfoethyl)anilino]ethanesulfonic acid |
|---|---|
| PubChem CID | 89300470 |
| Molecular Formula | C19H21NO7S2 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.08 |
| IUPAC Name | 2-[4-[(E)-3-oxo-3-phenylprop-1-enyl]-N-(2-sulfoethyl)anilino]ethanesulfonic acid |
| SMILES | O=C(/C=C/c1ccc(N(CCS(=O)(=O)O)CCS(=O)(=O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H21NO7S2/c21-19(17-4-2-1-3-5-17)11-8-16-6-9-18(10-7-16)20(12-14-28(22,23)24)13-15-29(25,26)27/h1-11H,12-15H2,(H,22,23,24)(H,25,26,27)/b11-8+ |
| InChIKey | FIKCETZAJKCGHM-DHZHZOJOSA-N |
| XLogP | 2.16 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|