C23H29N6O3S2- — CID 89325243
CID 89325243 (PubChem CID 89325243) has the molecular formula C23H29N6O3S2- and a molecular weight of 501.66 g/mol.
| Compound Name | CID 89325243 |
|---|---|
| PubChem CID | 89325243 |
| Molecular Formula | C23H29N6O3S2- |
| Molecular Weight | 501.66 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | — |
| SMILES | C[C@H](CO)Nc1nc(Nc2ccc(/[S-](=O)=N/CCN3CCOCC3)cc2)ncc1-c1cccs1 |
| InChI | InChI=1S/C23H29N6O3S2/c1-17(16-30)26-22-20(21-3-2-14-33-21)15-24-23(28-22)27-18-4-6-19(7-5-18)34(31)25-8-9-29-10-12-32-13-11-29/h2-7,14-15,17,30H,8-13,16H2,1H3,(H2,24,26,27,28)/q-1/t17-/m1/s1 |
| InChIKey | CSRXAMBWUYBXMM-QGZVFWFLSA-N |
| XLogP | 3.58 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.66 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|