About 3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiole 2-oxide
3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiole 2-oxide (PubChem CID 89343449) has the molecular formula C4H6O4S
and a molecular weight of 150.15 g/mol. Its IUPAC name is 3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiole 2-oxide.
Analyze 3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiole 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiole 2-oxide?
The IUPAC name of 3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiole 2-oxide (CID 89343449) is 3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiole 2-oxide.
What is the SMILES notation for 3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiole 2-oxide?
The canonical SMILES for 3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiole 2-oxide is O=S1OC2COCC2O1.
What is the InChIKey of 3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiole 2-oxide?
The InChIKey is AEJFZRWJLXEEDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O4S/c5-9-7-3-1-6-2-4(3)8-9/h3-4H,1-2H2.
What are the key properties of 3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiole 2-oxide?
3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiole 2-oxide has a molecular weight of 150.15 g/mol, XLogP of -0.62, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3a,4,6,6a-tetrahydrofuro[3,4-d][1,3,2]dioxathiole 2-oxide is sourced from PubChem (CID 89343449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).