C10H18O7S — CID 10850464
(4R)-4-[(4R,5R)-5-(dimethoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,3,2-dioxathiolane 2-oxide (PubChem CID 10850464) has the molecular formula C10H18O7S and a molecular weight of 282.31 g/mol. Its IUPAC name is (4R)-4-[(4R,5R)-5-(dimethoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,3,2-dioxathiolane 2-oxide.
| Compound Name | (4R)-4-[(4R,5R)-5-(dimethoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,3,2-dioxathiolane 2-oxide |
|---|---|
| PubChem CID | 10850464 |
| Molecular Formula | C10H18O7S |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | (4R)-4-[(4R,5R)-5-(dimethoxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,3,2-dioxathiolane 2-oxide |
| SMILES | COC(OC)[C@@H]1OC(C)(C)O[C@H]1[C@H]1COS(=O)O1 |
| InChI | InChI=1S/C10H18O7S/c1-10(2)15-7(6-5-14-18(11)17-6)8(16-10)9(12-3)13-4/h6-9H,5H2,1-4H3/t6-,7+,8-,18?/m1/s1 |
| InChIKey | KZLDQFXWCXNJFO-GMTWFCKWSA-N |
| XLogP | 0.12 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|