C47H53N — CID 89345053
N-[3-(9,9-dimethyl-7-pentan-3-ylfluoren-2-yl)hexan-3-yl]-4-methyl-N-[4-[(E)-2-phenylethenyl]phenyl]aniline (PubChem CID 89345053) has the molecular formula C47H53N and a molecular weight of 631.95 g/mol. Its IUPAC name is N-[3-(9,9-dimethyl-7-pentan-3-ylfluoren-2-yl)hexan-3-yl]-4-methyl-N-[4-[(E)-2-phenylethenyl]phenyl]aniline.
| Compound Name | N-[3-(9,9-dimethyl-7-pentan-3-ylfluoren-2-yl)hexan-3-yl]-4-methyl-N-[4-[(E)-2-phenylethenyl]phenyl]aniline |
|---|---|
| PubChem CID | 89345053 |
| Molecular Formula | C47H53N |
| Molecular Weight | 631.95 g/mol |
| Exact Mass | 631.42 |
| IUPAC Name | N-[3-(9,9-dimethyl-7-pentan-3-ylfluoren-2-yl)hexan-3-yl]-4-methyl-N-[4-[(E)-2-phenylethenyl]phenyl]aniline |
| SMILES | CCCC(CC)(c1ccc2c(c1)C(C)(C)c1cc(C(CC)CC)ccc1-2)N(c1ccc(C)cc1)c1ccc(/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C47H53N/c1-8-31-47(11-4,39-24-30-43-42-29-23-38(37(9-2)10-3)32-44(42)46(6,7)45(43)33-39)48(40-25-17-34(5)18-26-40)41-27-21-36(22-28-41)20-19-35-15-13-12-14-16-35/h12-30,32-33,37H,8-11,31H2,1-7H3/b20-19+ |
| InChIKey | RDJFQSUSTZRWRJ-FMQUCBEESA-N |
| XLogP | 13.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.95 |
| LogP ≤ 5 | 13.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|