C25H27Cl2N3O — CID 89360463
[[1-(3-chlorophenyl)-1-(5-chloro-2-pyridinyl)-2-phenylethyl]amino]-(cyclopentylamino)methanol (PubChem CID 89360463) has the molecular formula C25H27Cl2N3O and a molecular weight of 456.42 g/mol. Its IUPAC name is [[1-(3-chlorophenyl)-1-(5-chloro-2-pyridinyl)-2-phenylethyl]amino]-(cyclopentylamino)methanol.
| Compound Name | [[1-(3-chlorophenyl)-1-(5-chloro-2-pyridinyl)-2-phenylethyl]amino]-(cyclopentylamino)methanol |
|---|---|
| PubChem CID | 89360463 |
| Molecular Formula | C25H27Cl2N3O |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | [[1-(3-chlorophenyl)-1-(5-chloro-2-pyridinyl)-2-phenylethyl]amino]-(cyclopentylamino)methanol |
| SMILES | OC(NC1CCCC1)NC(Cc1ccccc1)(c1cccc(Cl)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C25H27Cl2N3O/c26-20-10-6-9-19(15-20)25(16-18-7-2-1-3-8-18,23-14-13-21(27)17-28-23)30-24(31)29-22-11-4-5-12-22/h1-3,6-10,13-15,17,22,24,29-31H,4-5,11-12,16H2 |
| InChIKey | IPLZVYNCUTWQCP-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|