C36H36Cl2O10S — CID 89365940
[1-[4-[4-[2-(3-chloropropanoyloxy)-3-phenoxypropoxy]phenyl]sulfonylphenoxy]-3-phenoxypropan-2-yl] 3-chloropropanoate (PubChem CID 89365940) has the molecular formula C36H36Cl2O10S and a molecular weight of 731.65 g/mol. Its IUPAC name is [1-[4-[4-[2-(3-chloropropanoyloxy)-3-phenoxypropoxy]phenyl]sulfonylphenoxy]-3-phenoxypropan-2-yl] 3-chloropropanoate.
| Compound Name | [1-[4-[4-[2-(3-chloropropanoyloxy)-3-phenoxypropoxy]phenyl]sulfonylphenoxy]-3-phenoxypropan-2-yl] 3-chloropropanoate |
|---|---|
| PubChem CID | 89365940 |
| Molecular Formula | C36H36Cl2O10S |
| Molecular Weight | 731.65 g/mol |
| Exact Mass | 730.14 |
| IUPAC Name | [1-[4-[4-[2-(3-chloropropanoyloxy)-3-phenoxypropoxy]phenyl]sulfonylphenoxy]-3-phenoxypropan-2-yl] 3-chloropropanoate |
| SMILES | O=C(CCCl)OC(COc1ccccc1)COc1ccc(S(=O)(=O)c2ccc(OCC(COc3ccccc3)OC(=O)CCCl)cc2)cc1 |
| InChI | InChI=1S/C36H36Cl2O10S/c37-21-19-35(39)47-31(23-43-27-7-3-1-4-8-27)25-45-29-11-15-33(16-12-29)49(41,42)34-17-13-30(14-18-34)46-26-32(48-36(40)20-22-38)24-44-28-9-5-2-6-10-28/h1-18,31-32H,19-26H2 |
| InChIKey | AYKOXMDNLZBWKJ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.65 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|