C21H26NO4S2+ — CID 89366128
[(1S,2S,4S,4'R)-4'-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxyspiro[5-oxabicyclo[2.1.0]pentane-2,2'-cyclopentane]-1'-yl]-trimethylazanium (PubChem CID 89366128) has the molecular formula C21H26NO4S2+ and a molecular weight of 420.58 g/mol. Its IUPAC name is [(1S,2S,4S,4'R)-4'-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxyspiro[5-oxabicyclo[2.1.0]pentane-2,2'-cyclopentane]-1'-yl]-trimethylazanium.
| Compound Name | [(1S,2S,4S,4'R)-4'-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxyspiro[5-oxabicyclo[2.1.0]pentane-2,2'-cyclopentane]-1'-yl]-trimethylazanium |
|---|---|
| PubChem CID | 89366128 |
| Molecular Formula | C21H26NO4S2+ |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | [(1S,2S,4S,4'R)-4'-(2-hydroxy-2,2-dithiophen-2-ylacetyl)oxyspiro[5-oxabicyclo[2.1.0]pentane-2,2'-cyclopentane]-1'-yl]-trimethylazanium |
| SMILES | C[N+](C)(C)C1C[C@H](OC(=O)C(O)(c2cccs2)c2cccs2)C[C@]12C[C@@H]1O[C@H]12 |
| InChI | InChI=1S/C21H26NO4S2/c1-22(2,3)15-10-13(11-20(15)12-14-18(20)26-14)25-19(23)21(24,16-6-4-8-27-16)17-7-5-9-28-17/h4-9,13-15,18,24H,10-12H2,1-3H3/q+1/t13-,14-,15?,18+,20-/m0/s1 |
| InChIKey | OIXVVMOYASOUII-YHIWDLBXSA-N |
| XLogP | 2.98 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|