C13H28OS — CID 89367394
(4R)-3-butylsulfanyl-2,6-dimethylheptan-4-ol (PubChem CID 89367394) has the molecular formula C13H28OS and a molecular weight of 232.43 g/mol. Its IUPAC name is (4R)-3-butylsulfanyl-2,6-dimethylheptan-4-ol.
| Compound Name | (4R)-3-butylsulfanyl-2,6-dimethylheptan-4-ol |
|---|---|
| PubChem CID | 89367394 |
| Molecular Formula | C13H28OS |
| Molecular Weight | 232.43 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | (4R)-3-butylsulfanyl-2,6-dimethylheptan-4-ol |
| SMILES | CCCCSC(C(C)C)[C@H](O)CC(C)C |
| InChI | InChI=1S/C13H28OS/c1-6-7-8-15-13(11(4)5)12(14)9-10(2)3/h10-14H,6-9H2,1-5H3/t12-,13?/m1/s1 |
| InChIKey | PPFPMVKQAYTPDE-PZORYLMUSA-N |
| XLogP | 3.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|