C32H34ClFN6O6 — CID 89385926
(E)-3-[4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-2-oxoethoxy]-3-methoxyphenyl]-N-[4-(3-chloro-4-fluoroanilino)quinazolin-6-yl]prop-2-enamide (PubChem CID 89385926) has the molecular formula C32H34ClFN6O6 and a molecular weight of 653.11 g/mol. Its IUPAC name is (E)-3-[4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-2-oxoethoxy]-3-methoxyphenyl]-N-[4-(3-chloro-4-fluoroanilino)quinazolin-6-yl]prop-2-enamide.
| Compound Name | (E)-3-[4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-2-oxoethoxy]-3-methoxyphenyl]-N-[4-(3-chloro-4-fluoroanilino)quinazolin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89385926 |
| Molecular Formula | C32H34ClFN6O6 |
| Molecular Weight | 653.11 g/mol |
| Exact Mass | 652.22 |
| IUPAC Name | (E)-3-[4-[2-[2-[2-(2-aminoethoxy)ethoxy]ethylamino]-2-oxoethoxy]-3-methoxyphenyl]-N-[4-(3-chloro-4-fluoroanilino)quinazolin-6-yl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccc3ncnc(Nc4ccc(F)c(Cl)c4)c3c2)ccc1OCC(=O)NCCOCCOCCN |
| InChI | InChI=1S/C32H34ClFN6O6/c1-43-29-16-21(2-8-28(29)46-19-31(42)36-11-13-45-15-14-44-12-10-35)3-9-30(41)39-22-5-7-27-24(17-22)32(38-20-37-27)40-23-4-6-26(34)25(33)18-23/h2-9,16-18,20H,10-15,19,35H2,1H3,(H,36,42)(H,39,41)(H,37,38,40)/b9-3+ |
| InChIKey | GVPJJCCZJBAFDH-YCRREMRBSA-N |
| XLogP | 4.31 |
| TPSA | 158.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.11 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|