C27H25ClFN5O4 — CID 91470856
3-[4-[[2-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxyethylamino]methyl]phenyl]-N-hydroxyprop-2-enamide (PubChem CID 91470856) has the molecular formula C27H25ClFN5O4 and a molecular weight of 537.98 g/mol. Its IUPAC name is 3-[4-[[2-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxyethylamino]methyl]phenyl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[4-[[2-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxyethylamino]methyl]phenyl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 91470856 |
| Molecular Formula | C27H25ClFN5O4 |
| Molecular Weight | 537.98 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | 3-[4-[[2-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxyethylamino]methyl]phenyl]-N-hydroxyprop-2-enamide |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1OCCNCc1ccc(C=CC(=O)NO)cc1 |
| InChI | InChI=1S/C27H25ClFN5O4/c1-37-24-14-23-20(27(32-16-31-23)33-19-7-8-22(29)21(28)12-19)13-25(24)38-11-10-30-15-18-4-2-17(3-5-18)6-9-26(35)34-36/h2-9,12-14,16,30,36H,10-11,15H2,1H3,(H,34,35)(H,31,32,33) |
| InChIKey | LBUPHUZBBYVKEM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 117.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.98 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|