C26H27ClFN5O4 — CID 143645995
4-[[2-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxyethylamino]methyl]benzaldehyde;N-methylhydroxylamine (PubChem CID 143645995) has the molecular formula C26H27ClFN5O4 and a molecular weight of 527.98 g/mol. Its IUPAC name is 4-[[2-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxyethylamino]methyl]benzaldehyde;N-methylhydroxylamine.
| Compound Name | 4-[[2-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxyethylamino]methyl]benzaldehyde;N-methylhydroxylamine |
|---|---|
| PubChem CID | 143645995 |
| Molecular Formula | C26H27ClFN5O4 |
| Molecular Weight | 527.98 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | 4-[[2-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]oxyethylamino]methyl]benzaldehyde;N-methylhydroxylamine |
| SMILES | CNO.COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1OCCNCc1ccc(C=O)cc1 |
| InChI | InChI=1S/C25H22ClFN4O3.CH5NO/c1-33-23-12-22-19(25(30-15-29-22)31-18-6-7-21(27)20(26)10-18)11-24(23)34-9-8-28-13-16-2-4-17(14-32)5-3-16;1-2-3/h2-7,10-12,14-15,28H,8-9,13H2,1H3,(H,29,30,31);2-3H,1H3 |
| InChIKey | OQYCXOSMALBFNZ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 117.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.98 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|