C50H84BN — CID 89400482
butyl-tris(2-tert-butylphenyl)boranuide;tetrabutylazanium (PubChem CID 89400482) has the molecular formula C50H84BN and a molecular weight of 710.04 g/mol. Its IUPAC name is butyl-tris(2-tert-butylphenyl)boranuide;tetrabutylazanium.
| Compound Name | butyl-tris(2-tert-butylphenyl)boranuide;tetrabutylazanium |
|---|---|
| PubChem CID | 89400482 |
| Molecular Formula | C50H84BN |
| Molecular Weight | 710.04 g/mol |
| Exact Mass | 709.67 |
| IUPAC Name | butyl-tris(2-tert-butylphenyl)boranuide;tetrabutylazanium |
| SMILES | CCCC[B-](c1ccccc1C(C)(C)C)(c1ccccc1C(C)(C)C)c1ccccc1C(C)(C)C.CCCC[N+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C34H48B.C16H36N/c1-11-12-25-35(29-22-16-13-19-26(29)32(2,3)4,30-23-17-14-20-27(30)33(5,6)7)31-24-18-15-21-28(31)34(8,9)10;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h13-24H,11-12,25H2,1-10H3;5-16H2,1-4H3/q-1;+1 |
| InChIKey | DVGQSJDQOXRPJA-UHFFFAOYSA-N |
| XLogP | 12.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.04 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|