C17H16BrF3O — CID 89408986
2-(bromomethyl)-4-tert-butyl-6-(2,4,6-trifluorophenyl)phenol (PubChem CID 89408986) has the molecular formula C17H16BrF3O and a molecular weight of 373.21 g/mol. Its IUPAC name is 2-(bromomethyl)-4-tert-butyl-6-(2,4,6-trifluorophenyl)phenol.
| Compound Name | 2-(bromomethyl)-4-tert-butyl-6-(2,4,6-trifluorophenyl)phenol |
|---|---|
| PubChem CID | 89408986 |
| Molecular Formula | C17H16BrF3O |
| Molecular Weight | 373.21 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | 2-(bromomethyl)-4-tert-butyl-6-(2,4,6-trifluorophenyl)phenol |
| SMILES | CC(C)(C)c1cc(CBr)c(O)c(-c2c(F)cc(F)cc2F)c1 |
| InChI | InChI=1S/C17H16BrF3O/c1-17(2,3)10-4-9(8-18)16(22)12(5-10)15-13(20)6-11(19)7-14(15)21/h4-7,22H,8H2,1-3H3 |
| InChIKey | NQGRYWFMTTWJFP-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.21 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|