About [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-[4-(1,3-dithiolan-2-yl)phenoxy]acetate
[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-[4-(1,3-dithiolan-2-yl)phenoxy]acetate (PubChem CID 8949655) has the molecular formula C16H17NO6S2
and a molecular weight of 383.45 g/mol. Its IUPAC name is [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-[4-(1,3-dithiolan-2-yl)phenoxy]acetate.
Molecular Properties
| Compound Name | [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-[4-(1,3-dithiolan-2-yl)phenoxy]acetate |
| PubChem CID | 8949655 |
| Molecular Formula | C16H17NO6S2 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-[4-(1,3-dithiolan-2-yl)phenoxy]acetate |
| SMILES | O=C(COc1ccc(C2SCCS2)cc1)OCC(=O)N1CCOC1=O |
| InChI | InChI=1S/C16H17NO6S2/c18-13(17-5-6-21-16(17)20)9-23-14(19)10-22-12-3-1-11(2-4-12)15-24-7-8-25-15/h1-4,15H,5-10H2 |
| InChIKey | AZQIFHCWNXNZBS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-[4-(1,3-dithiolan-2-yl)phenoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-[4-(1,3-dithiolan-2-yl)phenoxy]acetate?
The IUPAC name of [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-[4-(1,3-dithiolan-2-yl)phenoxy]acetate (CID 8949655) is [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-[4-(1,3-dithiolan-2-yl)phenoxy]acetate.
What is the SMILES notation for [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-[4-(1,3-dithiolan-2-yl)phenoxy]acetate?
The canonical SMILES for [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-[4-(1,3-dithiolan-2-yl)phenoxy]acetate is O=C(COc1ccc(C2SCCS2)cc1)OCC(=O)N1CCOC1=O.
What is the InChIKey of [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-[4-(1,3-dithiolan-2-yl)phenoxy]acetate?
The InChIKey is AZQIFHCWNXNZBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO6S2/c18-13(17-5-6-21-16(17)20)9-23-14(19)10-22-12-3-1-11(2-4-12)15-24-7-8-25-15/h1-4,15H,5-10H2.
What are the key properties of [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-[4-(1,3-dithiolan-2-yl)phenoxy]acetate?
[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-[4-(1,3-dithiolan-2-yl)phenoxy]acetate has a molecular weight of 383.45 g/mol, XLogP of 2.07, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl] 2-[4-(1,3-dithiolan-2-yl)phenoxy]acetate is sourced from PubChem (CID 8949655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).