About 2-phenylpyrrolo[2,3-d]imidazole
2-phenylpyrrolo[2,3-d]imidazole (PubChem CID 89499941) has the molecular formula C11H7N3
and a molecular weight of 181.20 g/mol. Its IUPAC name is 2-phenylpyrrolo[2,3-d]imidazole.
Molecular Properties
| Compound Name | 2-phenylpyrrolo[2,3-d]imidazole |
| PubChem CID | 89499941 |
| Molecular Formula | C11H7N3 |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.06 |
| IUPAC Name | 2-phenylpyrrolo[2,3-d]imidazole |
| SMILES | C1=NC2=NC(c3ccccc3)=NC2=C1 |
| InChI | InChI=1S/C11H7N3/c1-2-4-8(5-3-1)10-13-9-6-7-12-11(9)14-10/h1-7H |
| InChIKey | PDONFIMNFPOTHI-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenylpyrrolo[2,3-d]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylpyrrolo[2,3-d]imidazole?
The IUPAC name of 2-phenylpyrrolo[2,3-d]imidazole (CID 89499941) is 2-phenylpyrrolo[2,3-d]imidazole.
What is the SMILES notation for 2-phenylpyrrolo[2,3-d]imidazole?
The canonical SMILES for 2-phenylpyrrolo[2,3-d]imidazole is C1=NC2=NC(c3ccccc3)=NC2=C1.
What is the InChIKey of 2-phenylpyrrolo[2,3-d]imidazole?
The InChIKey is PDONFIMNFPOTHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3/c1-2-4-8(5-3-1)10-13-9-6-7-12-11(9)14-10/h1-7H.
What are the key properties of 2-phenylpyrrolo[2,3-d]imidazole?
2-phenylpyrrolo[2,3-d]imidazole has a molecular weight of 181.20 g/mol, XLogP of 1.81, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylpyrrolo[2,3-d]imidazole is sourced from PubChem (CID 89499941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).