C24H32N2 — CID 89530976
(3Z,5E)-N-(4-cyclohexa-1,3-dien-1-ylcyclohexyl)-6-methyl-1,2,10,10a-tetrahydro-1-benzazocin-7-amine (PubChem CID 89530976) has the molecular formula C24H32N2 and a molecular weight of 348.50 g/mol. Its IUPAC name is (3Z,5E)-N-(4-cyclohexa-1,3-dien-1-ylcyclohexyl)-6-methyl-1,2,10,10a-tetrahydro-1-benzazocin-7-amine.
| Compound Name | (3Z,5E)-N-(4-cyclohexa-1,3-dien-1-ylcyclohexyl)-6-methyl-1,2,10,10a-tetrahydro-1-benzazocin-7-amine |
|---|---|
| PubChem CID | 89530976 |
| Molecular Formula | C24H32N2 |
| Molecular Weight | 348.50 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | (3Z,5E)-N-(4-cyclohexa-1,3-dien-1-ylcyclohexyl)-6-methyl-1,2,10,10a-tetrahydro-1-benzazocin-7-amine |
| SMILES | C/C/1=C\C=C/CNC2C1=C(C=CC2)NC3CCC(CC3)C4=CC=CCC4 |
| InChI | InChI=1S/C24H32N2/c1-18-8-5-6-17-25-22-11-7-12-23(24(18)22)26-21-15-13-20(14-16-21)19-9-3-2-4-10-19/h2-3,5-9,12,20-22,25-26H,4,10-11,13-17H2,1H3/b6-5-,18-8+ |
| InChIKey | PPQOGVGUQAECLV-CWXWLJRESA-N |
| XLogP | 4.40 |
| TPSA | 24.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | 694 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |