C29H40N2O6S — CID 90013424
2-[decylsulfonyl-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]amino]acetic acid (PubChem CID 90013424) has the molecular formula C29H40N2O6S and a molecular weight of 544.71 g/mol. Its IUPAC name is 2-[decylsulfonyl-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]amino]acetic acid.
| Compound Name | 2-[decylsulfonyl-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 90013424 |
| Molecular Formula | C29H40N2O6S |
| Molecular Weight | 544.71 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | 2-[decylsulfonyl-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]amino]acetic acid |
| SMILES | CCCCCCCCCCS(=O)(=O)N(CCNC(=O)OCC1c2ccccc2-c2ccccc21)CC(=O)O |
| InChI | InChI=1S/C29H40N2O6S/c1-2-3-4-5-6-7-8-13-20-38(35,36)31(21-28(32)33)19-18-30-29(34)37-22-27-25-16-11-9-14-23(25)24-15-10-12-17-26(24)27/h9-12,14-17,27H,2-8,13,18-22H2,1H3,(H,30,34)(H,32,33) |
| InChIKey | UETSMAHNLDMOBW-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.71 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|