About [7-(ethylamino)-2,2-dimethyl-4-oxo-1,3-benzodioxin-5-yl] trifluoromethanesulfonate
[7-(ethylamino)-2,2-dimethyl-4-oxo-1,3-benzodioxin-5-yl] trifluoromethanesulfonate (PubChem CID 90048752) has the molecular formula C13H14F3NO6S
and a molecular weight of 369.32 g/mol. Its IUPAC name is [7-(ethylamino)-2,2-dimethyl-4-oxo-1,3-benzodioxin-5-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [7-(ethylamino)-2,2-dimethyl-4-oxo-1,3-benzodioxin-5-yl] trifluoromethanesulfonate |
| PubChem CID | 90048752 |
| Molecular Formula | C13H14F3NO6S |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | [7-(ethylamino)-2,2-dimethyl-4-oxo-1,3-benzodioxin-5-yl] trifluoromethanesulfonate |
| SMILES | CCNc1cc2c(c(OS(=O)(=O)C(F)(F)F)c1)C(=O)OC(C)(C)O2 |
| InChI | InChI=1S/C13H14F3NO6S/c1-4-17-7-5-8-10(11(18)22-12(2,3)21-8)9(6-7)23-24(19,20)13(14,15)16/h5-6,17H,4H2,1-3H3 |
| InChIKey | KITIMSWVMPYCIO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [7-(ethylamino)-2,2-dimethyl-4-oxo-1,3-benzodioxin-5-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [7-(ethylamino)-2,2-dimethyl-4-oxo-1,3-benzodioxin-5-yl] trifluoromethanesulfonate?
The IUPAC name of [7-(ethylamino)-2,2-dimethyl-4-oxo-1,3-benzodioxin-5-yl] trifluoromethanesulfonate (CID 90048752) is [7-(ethylamino)-2,2-dimethyl-4-oxo-1,3-benzodioxin-5-yl] trifluoromethanesulfonate.
What is the SMILES notation for [7-(ethylamino)-2,2-dimethyl-4-oxo-1,3-benzodioxin-5-yl] trifluoromethanesulfonate?
The canonical SMILES for [7-(ethylamino)-2,2-dimethyl-4-oxo-1,3-benzodioxin-5-yl] trifluoromethanesulfonate is CCNc1cc2c(c(OS(=O)(=O)C(F)(F)F)c1)C(=O)OC(C)(C)O2.
What is the InChIKey of [7-(ethylamino)-2,2-dimethyl-4-oxo-1,3-benzodioxin-5-yl] trifluoromethanesulfonate?
The InChIKey is KITIMSWVMPYCIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F3NO6S/c1-4-17-7-5-8-10(11(18)22-12(2,3)21-8)9(6-7)23-24(19,20)13(14,15)16/h5-6,17H,4H2,1-3H3.
What are the key properties of [7-(ethylamino)-2,2-dimethyl-4-oxo-1,3-benzodioxin-5-yl] trifluoromethanesulfonate?
[7-(ethylamino)-2,2-dimethyl-4-oxo-1,3-benzodioxin-5-yl] trifluoromethanesulfonate has a molecular weight of 369.32 g/mol, XLogP of 2.63, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [7-(ethylamino)-2,2-dimethyl-4-oxo-1,3-benzodioxin-5-yl] trifluoromethanesulfonate is sourced from PubChem (CID 90048752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).