C13H14F3NO6S — CID 90048752
[7-(ethylamino)-2,2-dimethyl-4-oxo-1,3-benzodioxin-5-yl] trifluoromethanesulfonate (PubChem CID 90048752) has the molecular formula C13H14F3NO6S and a molecular weight of 369.32 g/mol. Its IUPAC name is [7-(ethylamino)-2,2-dimethyl-4-oxo-1,3-benzodioxin-5-yl] trifluoromethanesulfonate.
| Compound Name | [7-(ethylamino)-2,2-dimethyl-4-oxo-1,3-benzodioxin-5-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 90048752 |
| Molecular Formula | C13H14F3NO6S |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | [7-(ethylamino)-2,2-dimethyl-4-oxo-1,3-benzodioxin-5-yl] trifluoromethanesulfonate |
| SMILES | CCNc1cc2c(c(OS(=O)(=O)C(F)(F)F)c1)C(=O)OC(C)(C)O2 |
| InChI | InChI=1S/C13H14F3NO6S/c1-4-17-7-5-8-10(11(18)22-12(2,3)21-8)9(6-7)23-24(19,20)13(14,15)16/h5-6,17H,4H2,1-3H3 |
| InChIKey | KITIMSWVMPYCIO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|