C9H11F5N4O3 — CID 90071801
2-(2-methyl-4-nitro-1,2-dihydroimidazol-3-yl)-N-(2,2,3,3,3-pentafluoropropyl)acetamide (PubChem CID 90071801) has the molecular formula C9H11F5N4O3 and a molecular weight of 318.20 g/mol. Its IUPAC name is 2-(2-methyl-4-nitro-1,2-dihydroimidazol-3-yl)-N-(2,2,3,3,3-pentafluoropropyl)acetamide.
| Compound Name | 2-(2-methyl-4-nitro-1,2-dihydroimidazol-3-yl)-N-(2,2,3,3,3-pentafluoropropyl)acetamide |
|---|---|
| PubChem CID | 90071801 |
| Molecular Formula | C9H11F5N4O3 |
| Molecular Weight | 318.20 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-(2-methyl-4-nitro-1,2-dihydroimidazol-3-yl)-N-(2,2,3,3,3-pentafluoropropyl)acetamide |
| SMILES | CC1NC=C([N+](=O)[O-])N1CC(=O)NCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H11F5N4O3/c1-5-15-2-7(18(20)21)17(5)3-6(19)16-4-8(10,11)9(12,13)14/h2,5,15H,3-4H2,1H3,(H,16,19) |
| InChIKey | XPSPWLHAKVNRQQ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 87.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.20 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|